C26H20F3N5O — CID 2439610
(E)-2-(1,2-dihydroimidazo[1,2-a]benzimidazole-3-carbonyl)-3-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]prop-2-enenitrile (PubChem CID 2439610) has the molecular formula C26H20F3N5O and a molecular weight of 475.47 g/mol. Its IUPAC name is (E)-2-(1,2-dihydroimidazo[1,2-a]benzimidazole-3-carbonyl)-3-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(1,2-dihydroimidazo[1,2-a]benzimidazole-3-carbonyl)-3-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 2439610 |
| Molecular Formula | C26H20F3N5O |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | (E)-2-(1,2-dihydroimidazo[1,2-a]benzimidazole-3-carbonyl)-3-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]prop-2-enenitrile |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)N2CCn3c2nc2ccccc23)c(C)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H20F3N5O/c1-16-12-18(17(2)34(16)21-7-5-6-20(14-21)26(27,28)29)13-19(15-30)24(35)33-11-10-32-23-9-4-3-8-22(23)31-25(32)33/h3-9,12-14H,10-11H2,1-2H3/b19-13+ |
| InChIKey | XQCVOSBSHLXPPL-CPNJWEJPSA-N |
| XLogP | 5.42 |
| TPSA | 66.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|