C23H22N2O2 — CID 2439637
propan-2-yl (Z)-2-cyano-3-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)prop-2-enoate (PubChem CID 2439637) has the molecular formula C23H22N2O2 and a molecular weight of 358.44 g/mol. Its IUPAC name is propan-2-yl (Z)-2-cyano-3-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)prop-2-enoate.
| Compound Name | propan-2-yl (Z)-2-cyano-3-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2439637 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | propan-2-yl (Z)-2-cyano-3-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)prop-2-enoate |
| SMILES | Cc1cc(/C=C(/C#N)C(=O)OC(C)C)c(C)n1-c1cccc2ccccc12 |
| InChI | InChI=1S/C23H22N2O2/c1-15(2)27-23(26)20(14-24)13-19-12-16(3)25(17(19)4)22-11-7-9-18-8-5-6-10-21(18)22/h5-13,15H,1-4H3/b20-13- |
| InChIKey | QJFUFEOZWTZUPK-MOSHPQCFSA-N |
| XLogP | 5.11 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|