C17H17ClNO4S- — CID 2439942
2-chloro-5-[[(2R)-4-phenylbutan-2-yl]sulfamoyl]benzoate (PubChem CID 2439942) has the molecular formula C17H17ClNO4S- and a molecular weight of 366.85 g/mol. Its IUPAC name is 2-chloro-5-[[(2R)-4-phenylbutan-2-yl]sulfamoyl]benzoate.
| Compound Name | 2-chloro-5-[[(2R)-4-phenylbutan-2-yl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2439942 |
| Molecular Formula | C17H17ClNO4S- |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 2-chloro-5-[[(2R)-4-phenylbutan-2-yl]sulfamoyl]benzoate |
| SMILES | C[C@H](CCc1ccccc1)NS(=O)(=O)c1ccc(Cl)c(C(=O)[O-])c1 |
| InChI | InChI=1S/C17H18ClNO4S/c1-12(7-8-13-5-3-2-4-6-13)19-24(22,23)14-9-10-16(18)15(11-14)17(20)21/h2-6,9-12,19H,7-8H2,1H3,(H,20,21)/p-1/t12-/m1/s1 |
| InChIKey | SSRBOENWLAHUDC-GFCCVEGCSA-M |
| XLogP | 2.00 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |