About 3-hydroxy-N,N-dimethylbenzotriazole-5-sulfonamide
3-hydroxy-N,N-dimethylbenzotriazole-5-sulfonamide (PubChem CID 2440022) has the molecular formula C8H10N4O3S
and a molecular weight of 242.26 g/mol. Its IUPAC name is 3-hydroxy-N,N-dimethylbenzotriazole-5-sulfonamide.
Molecular Properties
| Compound Name | 3-hydroxy-N,N-dimethylbenzotriazole-5-sulfonamide |
| PubChem CID | 2440022 |
| Molecular Formula | C8H10N4O3S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 3-hydroxy-N,N-dimethylbenzotriazole-5-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2nnn(O)c2c1 |
| InChI | InChI=1S/C8H10N4O3S/c1-11(2)16(14,15)6-3-4-7-8(5-6)12(13)10-9-7/h3-5,13H,1-2H3 |
| InChIKey | MMTNAHRIPAKUCD-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-N,N-dimethylbenzotriazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-N,N-dimethylbenzotriazole-5-sulfonamide?
The IUPAC name of 3-hydroxy-N,N-dimethylbenzotriazole-5-sulfonamide (CID 2440022) is 3-hydroxy-N,N-dimethylbenzotriazole-5-sulfonamide.
What is the SMILES notation for 3-hydroxy-N,N-dimethylbenzotriazole-5-sulfonamide?
The canonical SMILES for 3-hydroxy-N,N-dimethylbenzotriazole-5-sulfonamide is CN(C)S(=O)(=O)c1ccc2nnn(O)c2c1.
What is the InChIKey of 3-hydroxy-N,N-dimethylbenzotriazole-5-sulfonamide?
The InChIKey is MMTNAHRIPAKUCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O3S/c1-11(2)16(14,15)6-3-4-7-8(5-6)12(13)10-9-7/h3-5,13H,1-2H3.
What are the key properties of 3-hydroxy-N,N-dimethylbenzotriazole-5-sulfonamide?
3-hydroxy-N,N-dimethylbenzotriazole-5-sulfonamide has a molecular weight of 242.26 g/mol, XLogP of -0.08, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-N,N-dimethylbenzotriazole-5-sulfonamide is sourced from PubChem (CID 2440022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).