About (2-methyl-1,3-thiazol-4-yl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate
(2-methyl-1,3-thiazol-4-yl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate (PubChem CID 2440566) has the molecular formula C20H18N2O4S2
and a molecular weight of 414.51 g/mol. Its IUPAC name is (2-methyl-1,3-thiazol-4-yl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate.
Molecular Properties
| Compound Name | (2-methyl-1,3-thiazol-4-yl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
| PubChem CID | 2440566 |
| Molecular Formula | C20H18N2O4S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | (2-methyl-1,3-thiazol-4-yl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
| SMILES | Cc1nc(COC(=O)c2cccc(S(=O)(=O)N3CCc4ccccc43)c2)cs1 |
| InChI | InChI=1S/C20H18N2O4S2/c1-14-21-17(13-27-14)12-26-20(23)16-6-4-7-18(11-16)28(24,25)22-10-9-15-5-2-3-8-19(15)22/h2-8,11,13H,9-10,12H2,1H3 |
| InChIKey | VJKQFXMFYPFKOR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-methyl-1,3-thiazol-4-yl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-1,3-thiazol-4-yl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate?
The IUPAC name of (2-methyl-1,3-thiazol-4-yl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate (CID 2440566) is (2-methyl-1,3-thiazol-4-yl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate.
What is the SMILES notation for (2-methyl-1,3-thiazol-4-yl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate?
The canonical SMILES for (2-methyl-1,3-thiazol-4-yl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate is Cc1nc(COC(=O)c2cccc(S(=O)(=O)N3CCc4ccccc43)c2)cs1.
What is the InChIKey of (2-methyl-1,3-thiazol-4-yl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate?
The InChIKey is VJKQFXMFYPFKOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O4S2/c1-14-21-17(13-27-14)12-26-20(23)16-6-4-7-18(11-16)28(24,25)22-10-9-15-5-2-3-8-19(15)22/h2-8,11,13H,9-10,12H2,1H3.
What are the key properties of (2-methyl-1,3-thiazol-4-yl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate?
(2-methyl-1,3-thiazol-4-yl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate has a molecular weight of 414.51 g/mol, XLogP of 3.56, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-1,3-thiazol-4-yl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate is sourced from PubChem (CID 2440566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).