About 3,4-dimethyl-2-methylimino-N-phenyl-1,3-thiazole-5-carboxamide
3,4-dimethyl-2-methylimino-N-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 2440663) has the molecular formula C13H15N3OS
and a molecular weight of 261.35 g/mol. Its IUPAC name is 3,4-dimethyl-2-methylimino-N-phenyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 3,4-dimethyl-2-methylimino-N-phenyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 2440663 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 3,4-dimethyl-2-methylimino-N-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | C/N=c1\sc(C(=O)Nc2ccccc2)c(C)n1C |
| InChI | InChI=1S/C13H15N3OS/c1-9-11(18-13(14-2)16(9)3)12(17)15-10-7-5-4-6-8-10/h4-8H,1-3H3,(H,15,17)/b14-13- |
| InChIKey | UDNIJWFHFFDQNU-YPKPFQOOSA-N |
| XLogP | 2.18 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-2-methylimino-N-phenyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-2-methylimino-N-phenyl-1,3-thiazole-5-carboxamide?
The IUPAC name of 3,4-dimethyl-2-methylimino-N-phenyl-1,3-thiazole-5-carboxamide (CID 2440663) is 3,4-dimethyl-2-methylimino-N-phenyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 3,4-dimethyl-2-methylimino-N-phenyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 3,4-dimethyl-2-methylimino-N-phenyl-1,3-thiazole-5-carboxamide is C/N=c1\sc(C(=O)Nc2ccccc2)c(C)n1C.
What is the InChIKey of 3,4-dimethyl-2-methylimino-N-phenyl-1,3-thiazole-5-carboxamide?
The InChIKey is UDNIJWFHFFDQNU-YPKPFQOOSA-N. The full InChI is InChI=1S/C13H15N3OS/c1-9-11(18-13(14-2)16(9)3)12(17)15-10-7-5-4-6-8-10/h4-8H,1-3H3,(H,15,17)/b14-13-.
What are the key properties of 3,4-dimethyl-2-methylimino-N-phenyl-1,3-thiazole-5-carboxamide?
3,4-dimethyl-2-methylimino-N-phenyl-1,3-thiazole-5-carboxamide has a molecular weight of 261.35 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-2-methylimino-N-phenyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 2440663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).