C29H29N3O3 — CID 2442028
2-benzyl-N-[2-(2-methoxyphenoxy)ethyl]-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide (PubChem CID 2442028) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-benzyl-N-[2-(2-methoxyphenoxy)ethyl]-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide.
| Compound Name | 2-benzyl-N-[2-(2-methoxyphenoxy)ethyl]-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide |
|---|---|
| PubChem CID | 2442028 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 2-benzyl-N-[2-(2-methoxyphenoxy)ethyl]-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxamide |
| SMILES | COc1ccccc1OCCNC(=O)c1c2c(nc3ccccc13)CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C29H29N3O3/c1-34-26-13-7-8-14-27(26)35-18-16-30-29(33)28-22-11-5-6-12-24(22)31-25-15-17-32(20-23(25)28)19-21-9-3-2-4-10-21/h2-14H,15-20H2,1H3,(H,30,33) |
| InChIKey | OCWVRGZUVNFZLF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|