About 4-[[4-(benzotriazol-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]morpholine
4-[[4-(benzotriazol-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]morpholine (PubChem CID 2442310) has the molecular formula C19H20N6OS
and a molecular weight of 380.48 g/mol. Its IUPAC name is 4-[[4-(benzotriazol-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]morpholine.
Molecular Properties
| Compound Name | 4-[[4-(benzotriazol-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]morpholine |
| PubChem CID | 2442310 |
| Molecular Formula | C19H20N6OS |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 4-[[4-(benzotriazol-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]morpholine |
| SMILES | Cc1sc2nc(CN3CCOCC3)nc(-n3nnc4ccccc43)c2c1C |
| InChI | InChI=1S/C19H20N6OS/c1-12-13(2)27-19-17(12)18(25-15-6-4-3-5-14(15)22-23-25)20-16(21-19)11-24-7-9-26-10-8-24/h3-6H,7-11H2,1-2H3 |
| InChIKey | QFZSJRSOVUOBGM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-[[4-(benzotriazol-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(benzotriazol-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]morpholine?
The IUPAC name of 4-[[4-(benzotriazol-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]morpholine (CID 2442310) is 4-[[4-(benzotriazol-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]morpholine.
What is the SMILES notation for 4-[[4-(benzotriazol-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]morpholine?
The canonical SMILES for 4-[[4-(benzotriazol-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]morpholine is Cc1sc2nc(CN3CCOCC3)nc(-n3nnc4ccccc43)c2c1C.
What is the InChIKey of 4-[[4-(benzotriazol-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]morpholine?
The InChIKey is QFZSJRSOVUOBGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N6OS/c1-12-13(2)27-19-17(12)18(25-15-6-4-3-5-14(15)22-23-25)20-16(21-19)11-24-7-9-26-10-8-24/h3-6H,7-11H2,1-2H3.
What are the key properties of 4-[[4-(benzotriazol-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]morpholine?
4-[[4-(benzotriazol-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]morpholine has a molecular weight of 380.48 g/mol, XLogP of 2.87, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(benzotriazol-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]morpholine is sourced from PubChem (CID 2442310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).