About 1-[(2-chlorophenyl)methyl]-2,5-dimethylpyrrole
1-[(2-chlorophenyl)methyl]-2,5-dimethylpyrrole (PubChem CID 2442320) has the molecular formula C13H14ClN
and a molecular weight of 219.72 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-2,5-dimethylpyrrole.
Molecular Properties
| Compound Name | 1-[(2-chlorophenyl)methyl]-2,5-dimethylpyrrole |
| PubChem CID | 2442320 |
| Molecular Formula | C13H14ClN |
| Molecular Weight | 219.72 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-2,5-dimethylpyrrole |
| SMILES | Cc1ccc(C)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C13H14ClN/c1-10-7-8-11(2)15(10)9-12-5-3-4-6-13(12)14/h3-8H,9H2,1-2H3 |
| InChIKey | CJCMJPGNMBFFDC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.72 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(2-chlorophenyl)methyl]-2,5-dimethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-chlorophenyl)methyl]-2,5-dimethylpyrrole?
The IUPAC name of 1-[(2-chlorophenyl)methyl]-2,5-dimethylpyrrole (CID 2442320) is 1-[(2-chlorophenyl)methyl]-2,5-dimethylpyrrole.
What is the SMILES notation for 1-[(2-chlorophenyl)methyl]-2,5-dimethylpyrrole?
The canonical SMILES for 1-[(2-chlorophenyl)methyl]-2,5-dimethylpyrrole is Cc1ccc(C)n1Cc1ccccc1Cl.
What is the InChIKey of 1-[(2-chlorophenyl)methyl]-2,5-dimethylpyrrole?
The InChIKey is CJCMJPGNMBFFDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClN/c1-10-7-8-11(2)15(10)9-12-5-3-4-6-13(12)14/h3-8H,9H2,1-2H3.
What are the key properties of 1-[(2-chlorophenyl)methyl]-2,5-dimethylpyrrole?
1-[(2-chlorophenyl)methyl]-2,5-dimethylpyrrole has a molecular weight of 219.72 g/mol, XLogP of 3.81, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-chlorophenyl)methyl]-2,5-dimethylpyrrole is sourced from PubChem (CID 2442320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).