About 2-(2-fluorophenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide
2-(2-fluorophenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 2442759) has the molecular formula C16H12FN3OS
and a molecular weight of 313.36 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(2-fluorophenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 2442759 |
| Molecular Formula | C16H12FN3OS |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-(2-fluorophenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(Cc1ccccc1F)Nc1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C16H12FN3OS/c17-13-6-2-1-4-11(13)8-15(21)20-16-19-14(10-22-16)12-5-3-7-18-9-12/h1-7,9-10H,8H2,(H,19,20,21) |
| InChIKey | JICNPBKPOBRLLG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-fluorophenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluorophenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-(2-fluorophenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide (CID 2442759) is 2-(2-fluorophenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-(2-fluorophenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-(2-fluorophenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide is O=C(Cc1ccccc1F)Nc1nc(-c2cccnc2)cs1.
What is the InChIKey of 2-(2-fluorophenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide?
The InChIKey is JICNPBKPOBRLLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12FN3OS/c17-13-6-2-1-4-11(13)8-15(21)20-16-19-14(10-22-16)12-5-3-7-18-9-12/h1-7,9-10H,8H2,(H,19,20,21).
What are the key properties of 2-(2-fluorophenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide?
2-(2-fluorophenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide has a molecular weight of 313.36 g/mol, XLogP of 3.53, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluorophenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 2442759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).