About N-cyclopentyl-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide
N-cyclopentyl-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide (PubChem CID 2442931) has the molecular formula C16H19N3O3
and a molecular weight of 301.35 g/mol. Its IUPAC name is N-cyclopentyl-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide.
Molecular Properties
| Compound Name | N-cyclopentyl-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide |
| PubChem CID | 2442931 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-cyclopentyl-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)NC3CCCC3)ccc21 |
| InChI | InChI=1S/C16H19N3O3/c1-2-19-13-8-7-10(9-12(13)18-15(21)16(19)22)14(20)17-11-5-3-4-6-11/h7-9,11H,2-6H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | PERLOKLEBFVALK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopentyl-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide?
The IUPAC name of N-cyclopentyl-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide (CID 2442931) is N-cyclopentyl-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide.
What is the SMILES notation for N-cyclopentyl-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide?
The canonical SMILES for N-cyclopentyl-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide is CCn1c(=O)c(=O)[nH]c2cc(C(=O)NC3CCCC3)ccc21.
What is the InChIKey of N-cyclopentyl-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide?
The InChIKey is PERLOKLEBFVALK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O3/c1-2-19-13-8-7-10(9-12(13)18-15(21)16(19)22)14(20)17-11-5-3-4-6-11/h7-9,11H,2-6H2,1H3,(H,17,20)(H,18,21).
What are the key properties of N-cyclopentyl-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide?
N-cyclopentyl-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide has a molecular weight of 301.35 g/mol, XLogP of 1.38, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide is sourced from PubChem (CID 2442931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).