C12H19N2O+ — CID 2443104
ethyl-[(2R)-1-(4-methylanilino)-1-oxopropan-2-yl]azanium (PubChem CID 2443104) has the molecular formula C12H19N2O+ and a molecular weight of 207.30 g/mol. Its IUPAC name is ethyl-[(2R)-1-(4-methylanilino)-1-oxopropan-2-yl]azanium.
| Compound Name | ethyl-[(2R)-1-(4-methylanilino)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 2443104 |
| Molecular Formula | C12H19N2O+ |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | ethyl-[(2R)-1-(4-methylanilino)-1-oxopropan-2-yl]azanium |
| SMILES | CC[NH2+][C@H](C)C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C12H18N2O/c1-4-13-10(3)12(15)14-11-7-5-9(2)6-8-11/h5-8,10,13H,4H2,1-3H3,(H,14,15)/p+1/t10-/m1/s1 |
| InChIKey | NWIGWRRGIBDVBP-SNVBAGLBSA-O |
| XLogP | 0.91 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |