About 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate
2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate (PubChem CID 2443161) has the molecular formula C8H5BrF2NO4S-
and a molecular weight of 329.10 g/mol. Its IUPAC name is 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate.
Molecular Properties
| Compound Name | 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate |
| PubChem CID | 2443161 |
| Molecular Formula | C8H5BrF2NO4S- |
| Molecular Weight | 329.10 g/mol |
| Exact Mass | 327.91 |
| IUPAC Name | 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate |
| SMILES | O=C([O-])CNS(=O)(=O)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C8H6BrF2NO4S/c9-5-1-4(10)2-6(11)8(5)17(15,16)12-3-7(13)14/h1-2,12H,3H2,(H,13,14)/p-1 |
| InChIKey | ZQCWRKUFGZPDDN-UHFFFAOYSA-M |
| XLogP | -0.24 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.10 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate?
The IUPAC name of 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate (CID 2443161) is 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate.
What is the SMILES notation for 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate?
The canonical SMILES for 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate is O=C([O-])CNS(=O)(=O)c1c(F)cc(F)cc1Br.
What is the InChIKey of 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate?
The InChIKey is ZQCWRKUFGZPDDN-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H6BrF2NO4S/c9-5-1-4(10)2-6(11)8(5)17(15,16)12-3-7(13)14/h1-2,12H,3H2,(H,13,14)/p-1.
What are the key properties of 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate?
2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate has a molecular weight of 329.10 g/mol, XLogP of -0.24, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate is sourced from PubChem (CID 2443161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).