C16H32O — CID 244347
Heptane,3-[[(2-ethyl-1-hexen-1-yl)oxy]methyl]- (PubChem CID 244347) has the molecular formula C16H32O and a molecular weight of 240.42 g/mol. Its IUPAC name is 3-(2-ethylhex-1-enoxymethyl)heptane.
| Compound Name | Heptane,3-[[(2-ethyl-1-hexen-1-yl)oxy]methyl]- |
|---|---|
| PubChem CID | 244347 |
| Molecular Formula | C16H32O |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.25 |
| IUPAC Name | 3-(2-ethylhex-1-enoxymethyl)heptane |
| SMILES | CCCCC(CC)COC=C(CC)CCCC |
| InChI | InChI=1S/C16H32O/c1-5-9-11-15(7-3)13-17-14-16(8-4)12-10-6-2/h13,16H,5-12,14H2,1-4H3 |
| InChIKey | NNHJCFOHRZGCJX-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 9.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | 184 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|