About 3-[benzyl-(2,6-dichlorophenyl)sulfonylamino]propanoic acid
3-[benzyl-(2,6-dichlorophenyl)sulfonylamino]propanoic acid (PubChem CID 2443723) has the molecular formula C16H15Cl2NO4S
and a molecular weight of 388.27 g/mol. Its IUPAC name is 3-[benzyl-(2,6-dichlorophenyl)sulfonylamino]propanoic acid.
Molecular Properties
| Compound Name | 3-[benzyl-(2,6-dichlorophenyl)sulfonylamino]propanoic acid |
| PubChem CID | 2443723 |
| Molecular Formula | C16H15Cl2NO4S |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | 3-[benzyl-(2,6-dichlorophenyl)sulfonylamino]propanoic acid |
| SMILES | O=C(O)CCN(Cc1ccccc1)S(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H15Cl2NO4S/c17-13-7-4-8-14(18)16(13)24(22,23)19(10-9-15(20)21)11-12-5-2-1-3-6-12/h1-8H,9-11H2,(H,20,21) |
| InChIKey | VSRSQRYILCZIFO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[benzyl-(2,6-dichlorophenyl)sulfonylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[benzyl-(2,6-dichlorophenyl)sulfonylamino]propanoic acid?
The IUPAC name of 3-[benzyl-(2,6-dichlorophenyl)sulfonylamino]propanoic acid (CID 2443723) is 3-[benzyl-(2,6-dichlorophenyl)sulfonylamino]propanoic acid.
What is the SMILES notation for 3-[benzyl-(2,6-dichlorophenyl)sulfonylamino]propanoic acid?
The canonical SMILES for 3-[benzyl-(2,6-dichlorophenyl)sulfonylamino]propanoic acid is O=C(O)CCN(Cc1ccccc1)S(=O)(=O)c1c(Cl)cccc1Cl.
What is the InChIKey of 3-[benzyl-(2,6-dichlorophenyl)sulfonylamino]propanoic acid?
The InChIKey is VSRSQRYILCZIFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15Cl2NO4S/c17-13-7-4-8-14(18)16(13)24(22,23)19(10-9-15(20)21)11-12-5-2-1-3-6-12/h1-8H,9-11H2,(H,20,21).
What are the key properties of 3-[benzyl-(2,6-dichlorophenyl)sulfonylamino]propanoic acid?
3-[benzyl-(2,6-dichlorophenyl)sulfonylamino]propanoic acid has a molecular weight of 388.27 g/mol, XLogP of 3.66, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[benzyl-(2,6-dichlorophenyl)sulfonylamino]propanoic acid is sourced from PubChem (CID 2443723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).