About N-benzo[e][1,3]benzothiazol-2-yl-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide
N-benzo[e][1,3]benzothiazol-2-yl-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide (PubChem CID 2444823) has the molecular formula C24H24N4O3S2
and a molecular weight of 480.62 g/mol. Its IUPAC name is N-benzo[e][1,3]benzothiazol-2-yl-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide.
Molecular Properties
| Compound Name | N-benzo[e][1,3]benzothiazol-2-yl-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide |
| PubChem CID | 2444823 |
| Molecular Formula | C24H24N4O3S2 |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | N-benzo[e][1,3]benzothiazol-2-yl-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(N2CCCC2)c(C(=O)Nc2nc3c(ccc4ccccc43)s2)c1 |
| InChI | InChI=1S/C24H24N4O3S2/c1-27(2)33(30,31)17-10-11-20(28-13-5-6-14-28)19(15-17)23(29)26-24-25-22-18-8-4-3-7-16(18)9-12-21(22)32-24/h3-4,7-12,15H,5-6,13-14H2,1-2H3,(H,25,26,29) |
| InChIKey | OHCNDMOAEDGSPK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-benzo[e][1,3]benzothiazol-2-yl-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzo[e][1,3]benzothiazol-2-yl-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide?
The IUPAC name of N-benzo[e][1,3]benzothiazol-2-yl-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide (CID 2444823) is N-benzo[e][1,3]benzothiazol-2-yl-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide.
What is the SMILES notation for N-benzo[e][1,3]benzothiazol-2-yl-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide?
The canonical SMILES for N-benzo[e][1,3]benzothiazol-2-yl-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide is CN(C)S(=O)(=O)c1ccc(N2CCCC2)c(C(=O)Nc2nc3c(ccc4ccccc43)s2)c1.
What is the InChIKey of N-benzo[e][1,3]benzothiazol-2-yl-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide?
The InChIKey is OHCNDMOAEDGSPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N4O3S2/c1-27(2)33(30,31)17-10-11-20(28-13-5-6-14-28)19(15-17)23(29)26-24-25-22-18-8-4-3-7-16(18)9-12-21(22)32-24/h3-4,7-12,15H,5-6,13-14H2,1-2H3,(H,25,26,29).
What are the key properties of N-benzo[e][1,3]benzothiazol-2-yl-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide?
N-benzo[e][1,3]benzothiazol-2-yl-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide has a molecular weight of 480.62 g/mol, XLogP of 4.55, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzo[e][1,3]benzothiazol-2-yl-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide is sourced from PubChem (CID 2444823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).