C17H16Cl2O2 — CID 2445360
(3-methyl-5-propan-2-ylphenyl) 3,5-dichlorobenzoate (PubChem CID 2445360) has the molecular formula C17H16Cl2O2 and a molecular weight of 323.22 g/mol. Its IUPAC name is (3-methyl-5-propan-2-ylphenyl) 3,5-dichlorobenzoate.
| Compound Name | (3-methyl-5-propan-2-ylphenyl) 3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 2445360 |
| Molecular Formula | C17H16Cl2O2 |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | (3-methyl-5-propan-2-ylphenyl) 3,5-dichlorobenzoate |
| SMILES | Cc1cc(OC(=O)c2cc(Cl)cc(Cl)c2)cc(C(C)C)c1 |
| InChI | InChI=1S/C17H16Cl2O2/c1-10(2)12-4-11(3)5-16(8-12)21-17(20)13-6-14(18)9-15(19)7-13/h4-10H,1-3H3 |
| InChIKey | MAVFVTNQDODYED-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|