About [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-ethylbenzoate
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-ethylbenzoate (PubChem CID 2445929) has the molecular formula C13H14F3NO3
and a molecular weight of 289.25 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-ethylbenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-ethylbenzoate |
| PubChem CID | 2445929 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)OCC(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F3NO3/c1-2-9-3-5-10(6-4-9)12(19)20-7-11(18)17-8-13(14,15)16/h3-6H,2,7-8H2,1H3,(H,17,18) |
| InChIKey | XSILANFSEVEIRA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-ethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-ethylbenzoate?
The IUPAC name of [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-ethylbenzoate (CID 2445929) is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-ethylbenzoate.
What is the SMILES notation for [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-ethylbenzoate?
The canonical SMILES for [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-ethylbenzoate is CCc1ccc(C(=O)OCC(=O)NCC(F)(F)F)cc1.
What is the InChIKey of [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-ethylbenzoate?
The InChIKey is XSILANFSEVEIRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F3NO3/c1-2-9-3-5-10(6-4-9)12(19)20-7-11(18)17-8-13(14,15)16/h3-6H,2,7-8H2,1H3,(H,17,18).
What are the key properties of [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-ethylbenzoate?
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-ethylbenzoate has a molecular weight of 289.25 g/mol, XLogP of 2.08, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-ethylbenzoate is sourced from PubChem (CID 2445929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).