C12H16ClNO3 — CID 2447530
(2S,5S)-5-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-oxazolidine (PubChem CID 2447530) has the molecular formula C12H16ClNO3 and a molecular weight of 257.72 g/mol. Its IUPAC name is (2S,5S)-5-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-oxazolidine.
| Compound Name | (2S,5S)-5-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 2447530 |
| Molecular Formula | C12H16ClNO3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | (2S,5S)-5-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-oxazolidine |
| SMILES | COc1ccc([C@H]2NC[C@@H](CCl)O2)c(OC)c1 |
| InChI | InChI=1S/C12H16ClNO3/c1-15-8-3-4-10(11(5-8)16-2)12-14-7-9(6-13)17-12/h3-5,9,12,14H,6-7H2,1-2H3/t9-,12+/m1/s1 |
| InChIKey | CQHZVDXJJIDZJS-SKDRFNHKSA-N |
| XLogP | 1.93 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|