C24H19Cl2N3O2S — CID 2447613
S-[4-(3,4-dichlorophenyl)-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl] 3,5-dimethylbenzenecarbothioate (PubChem CID 2447613) has the molecular formula C24H19Cl2N3O2S and a molecular weight of 484.41 g/mol. Its IUPAC name is S-[4-(3,4-dichlorophenyl)-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl] 3,5-dimethylbenzenecarbothioate.
| Compound Name | S-[4-(3,4-dichlorophenyl)-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl] 3,5-dimethylbenzenecarbothioate |
|---|---|
| PubChem CID | 2447613 |
| Molecular Formula | C24H19Cl2N3O2S |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | S-[4-(3,4-dichlorophenyl)-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl] 3,5-dimethylbenzenecarbothioate |
| SMILES | COc1ccc(-c2nnc(SC(=O)c3cc(C)cc(C)c3)n2-c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H19Cl2N3O2S/c1-14-10-15(2)12-17(11-14)23(30)32-24-28-27-22(16-4-7-19(31-3)8-5-16)29(24)18-6-9-20(25)21(26)13-18/h4-13H,1-3H3 |
| InChIKey | OBFKYCFAGPNMGH-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|