About N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-methylthiophene-2-carboxamide
N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-methylthiophene-2-carboxamide (PubChem CID 2447615) has the molecular formula C19H14N2O2S2
and a molecular weight of 366.47 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-methylthiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-methylthiophene-2-carboxamide |
| PubChem CID | 2447615 |
| Molecular Formula | C19H14N2O2S2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-methylthiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)Nc1ccc(O)c(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C19H14N2O2S2/c1-11-8-9-24-17(11)18(23)20-12-6-7-15(22)13(10-12)19-21-14-4-2-3-5-16(14)25-19/h2-10,22H,1H3,(H,20,23) |
| InChIKey | WGYDGVPXPLIPIR-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-methylthiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-methylthiophene-2-carboxamide?
The IUPAC name of N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-methylthiophene-2-carboxamide (CID 2447615) is N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-methylthiophene-2-carboxamide.
What is the SMILES notation for N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-methylthiophene-2-carboxamide?
The canonical SMILES for N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-methylthiophene-2-carboxamide is Cc1ccsc1C(=O)Nc1ccc(O)c(-c2nc3ccccc3s2)c1.
What is the InChIKey of N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-methylthiophene-2-carboxamide?
The InChIKey is WGYDGVPXPLIPIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N2O2S2/c1-11-8-9-24-17(11)18(23)20-12-6-7-15(22)13(10-12)19-21-14-4-2-3-5-16(14)25-19/h2-10,22H,1H3,(H,20,23).
What are the key properties of N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-methylthiophene-2-carboxamide?
N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-methylthiophene-2-carboxamide has a molecular weight of 366.47 g/mol, XLogP of 5.29, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-methylthiophene-2-carboxamide is sourced from PubChem (CID 2447615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).