About 4-aminopyrido[1,2-a]pyrimidin-2-one
4-aminopyrido[1,2-a]pyrimidin-2-one (PubChem CID 2447710) has the molecular formula C8H7N3O
and a molecular weight of 161.16 g/mol. Its IUPAC name is 4-aminopyrido[1,2-a]pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-aminopyrido[1,2-a]pyrimidin-2-one |
| PubChem CID | 2447710 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 4-aminopyrido[1,2-a]pyrimidin-2-one |
| SMILES | Nc1cc(=O)nc2ccccn12 |
| InChI | InChI=1S/C8H7N3O/c9-6-5-8(12)10-7-3-1-2-4-11(6)7/h1-5H,9H2 |
| InChIKey | RICATKUAAUKJHM-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-aminopyrido[1,2-a]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminopyrido[1,2-a]pyrimidin-2-one?
The IUPAC name of 4-aminopyrido[1,2-a]pyrimidin-2-one (CID 2447710) is 4-aminopyrido[1,2-a]pyrimidin-2-one.
What is the SMILES notation for 4-aminopyrido[1,2-a]pyrimidin-2-one?
The canonical SMILES for 4-aminopyrido[1,2-a]pyrimidin-2-one is Nc1cc(=O)nc2ccccn12.
What is the InChIKey of 4-aminopyrido[1,2-a]pyrimidin-2-one?
The InChIKey is RICATKUAAUKJHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O/c9-6-5-8(12)10-7-3-1-2-4-11(6)7/h1-5H,9H2.
What are the key properties of 4-aminopyrido[1,2-a]pyrimidin-2-one?
4-aminopyrido[1,2-a]pyrimidin-2-one has a molecular weight of 161.16 g/mol, XLogP of 0.28, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminopyrido[1,2-a]pyrimidin-2-one is sourced from PubChem (CID 2447710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).