C22H20ClN3O5S — CID 2447787
N-[2-[4-[(4-chlorophenyl)sulfamoyl]anilino]-2-oxoethyl]-4-methoxybenzamide (PubChem CID 2447787) has the molecular formula C22H20ClN3O5S and a molecular weight of 473.94 g/mol. Its IUPAC name is N-[2-[4-[(4-chlorophenyl)sulfamoyl]anilino]-2-oxoethyl]-4-methoxybenzamide.
| Compound Name | N-[2-[4-[(4-chlorophenyl)sulfamoyl]anilino]-2-oxoethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 2447787 |
| Molecular Formula | C22H20ClN3O5S |
| Molecular Weight | 473.94 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | N-[2-[4-[(4-chlorophenyl)sulfamoyl]anilino]-2-oxoethyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC(=O)Nc2ccc(S(=O)(=O)Nc3ccc(Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H20ClN3O5S/c1-31-19-10-2-15(3-11-19)22(28)24-14-21(27)25-17-8-12-20(13-9-17)32(29,30)26-18-6-4-16(23)5-7-18/h2-13,26H,14H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | AWZGVEAWUNXABX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.94 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |