C19H22N6O2 — CID 2449889
N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]-4-(tetrazol-1-yl)benzamide (PubChem CID 2449889) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]-4-(tetrazol-1-yl)benzamide.
| Compound Name | N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]-4-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 2449889 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]-4-(tetrazol-1-yl)benzamide |
| SMILES | O=C(NC[C@H](c1ccco1)N1CCCCC1)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C19H22N6O2/c26-19(15-6-8-16(9-7-15)25-14-21-22-23-25)20-13-17(18-5-4-12-27-18)24-10-2-1-3-11-24/h4-9,12,14,17H,1-3,10-11,13H2,(H,20,26)/t17-/m1/s1 |
| InChIKey | DXZKXXBUXPPNPV-QGZVFWFLSA-N |
| XLogP | 2.21 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |