C20H22N4O3S — CID 24500039
N-(butylcarbamoyl)-2-(5-methyl-4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide (PubChem CID 24500039) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is N-(butylcarbamoyl)-2-(5-methyl-4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-(butylcarbamoyl)-2-(5-methyl-4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 24500039 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-(butylcarbamoyl)-2-(5-methyl-4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)acetamide |
| SMILES | CCCCNC(=O)NC(=O)Cn1cnc2sc(-c3ccccc3)c(C)c2c1=O |
| InChI | InChI=1S/C20H22N4O3S/c1-3-4-10-21-20(27)23-15(25)11-24-12-22-18-16(19(24)26)13(2)17(28-18)14-8-6-5-7-9-14/h5-9,12H,3-4,10-11H2,1-2H3,(H2,21,23,25,27) |
| InChIKey | HYJTZADUBQWUPE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|