About (4-oxo-4-phenylbutyl) 2-methoxy-5-sulfamoylbenzoate
(4-oxo-4-phenylbutyl) 2-methoxy-5-sulfamoylbenzoate (PubChem CID 2450004) has the molecular formula C18H19NO6S
and a molecular weight of 377.42 g/mol. Its IUPAC name is (4-oxo-4-phenylbutyl) 2-methoxy-5-sulfamoylbenzoate.
Molecular Properties
| Compound Name | (4-oxo-4-phenylbutyl) 2-methoxy-5-sulfamoylbenzoate |
| PubChem CID | 2450004 |
| Molecular Formula | C18H19NO6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | (4-oxo-4-phenylbutyl) 2-methoxy-5-sulfamoylbenzoate |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)OCCCC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19NO6S/c1-24-17-10-9-14(26(19,22)23)12-15(17)18(21)25-11-5-8-16(20)13-6-3-2-4-7-13/h2-4,6-7,9-10,12H,5,8,11H2,1H3,(H2,19,22,23) |
| InChIKey | JELMILOKEKSPDN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-oxo-4-phenylbutyl) 2-methoxy-5-sulfamoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxo-4-phenylbutyl) 2-methoxy-5-sulfamoylbenzoate?
The IUPAC name of (4-oxo-4-phenylbutyl) 2-methoxy-5-sulfamoylbenzoate (CID 2450004) is (4-oxo-4-phenylbutyl) 2-methoxy-5-sulfamoylbenzoate.
What is the SMILES notation for (4-oxo-4-phenylbutyl) 2-methoxy-5-sulfamoylbenzoate?
The canonical SMILES for (4-oxo-4-phenylbutyl) 2-methoxy-5-sulfamoylbenzoate is COc1ccc(S(N)(=O)=O)cc1C(=O)OCCCC(=O)c1ccccc1.
What is the InChIKey of (4-oxo-4-phenylbutyl) 2-methoxy-5-sulfamoylbenzoate?
The InChIKey is JELMILOKEKSPDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO6S/c1-24-17-10-9-14(26(19,22)23)12-15(17)18(21)25-11-5-8-16(20)13-6-3-2-4-7-13/h2-4,6-7,9-10,12H,5,8,11H2,1H3,(H2,19,22,23).
What are the key properties of (4-oxo-4-phenylbutyl) 2-methoxy-5-sulfamoylbenzoate?
(4-oxo-4-phenylbutyl) 2-methoxy-5-sulfamoylbenzoate has a molecular weight of 377.42 g/mol, XLogP of 2.16, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-4-phenylbutyl) 2-methoxy-5-sulfamoylbenzoate is sourced from PubChem (CID 2450004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).