C20H28N6O2S — CID 24500102
N-(butylcarbamoyl)-2-[(4-phenyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 24500102) has the molecular formula C20H28N6O2S and a molecular weight of 416.55 g/mol. Its IUPAC name is N-(butylcarbamoyl)-2-[(4-phenyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(butylcarbamoyl)-2-[(4-phenyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 24500102 |
| Molecular Formula | C20H28N6O2S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | N-(butylcarbamoyl)-2-[(4-phenyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | CCCCNC(=O)NC(=O)CSc1nnc(N2CCCCC2)n1-c1ccccc1 |
| InChI | InChI=1S/C20H28N6O2S/c1-2-3-12-21-18(28)22-17(27)15-29-20-24-23-19(25-13-8-5-9-14-25)26(20)16-10-6-4-7-11-16/h4,6-7,10-11H,2-3,5,8-9,12-15H2,1H3,(H2,21,22,27,28) |
| InChIKey | BTNHFQGNGLZSDI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|