About (2-oxo-2-pyrrolidin-1-ylethyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate
(2-oxo-2-pyrrolidin-1-ylethyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate (PubChem CID 2450031) has the molecular formula C17H18N2O4
and a molecular weight of 314.34 g/mol. Its IUPAC name is (2-oxo-2-pyrrolidin-1-ylethyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | (2-oxo-2-pyrrolidin-1-ylethyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
| PubChem CID | 2450031 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (2-oxo-2-pyrrolidin-1-ylethyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)OCC(=O)N1CCCC1 |
| InChI | InChI=1S/C17H18N2O4/c1-12-15(16(18-23-12)13-7-3-2-4-8-13)17(21)22-11-14(20)19-9-5-6-10-19/h2-4,7-8H,5-6,9-11H2,1H3 |
| InChIKey | MPSZWIFLFSLGDD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-oxo-2-pyrrolidin-1-ylethyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-2-pyrrolidin-1-ylethyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate?
The IUPAC name of (2-oxo-2-pyrrolidin-1-ylethyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate (CID 2450031) is (2-oxo-2-pyrrolidin-1-ylethyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate.
What is the SMILES notation for (2-oxo-2-pyrrolidin-1-ylethyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate?
The canonical SMILES for (2-oxo-2-pyrrolidin-1-ylethyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate is Cc1onc(-c2ccccc2)c1C(=O)OCC(=O)N1CCCC1.
What is the InChIKey of (2-oxo-2-pyrrolidin-1-ylethyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate?
The InChIKey is MPSZWIFLFSLGDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O4/c1-12-15(16(18-23-12)13-7-3-2-4-8-13)17(21)22-11-14(20)19-9-5-6-10-19/h2-4,7-8H,5-6,9-11H2,1H3.
What are the key properties of (2-oxo-2-pyrrolidin-1-ylethyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate?
(2-oxo-2-pyrrolidin-1-ylethyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate has a molecular weight of 314.34 g/mol, XLogP of 2.43, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-2-pyrrolidin-1-ylethyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 2450031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).