About (1-phenyltetrazol-5-yl)methyl thieno[3,2-b][1]benzothiole-2-carboxylate
(1-phenyltetrazol-5-yl)methyl thieno[3,2-b][1]benzothiole-2-carboxylate (PubChem CID 24501181) has the molecular formula C19H12N4O2S2
and a molecular weight of 392.47 g/mol. Its IUPAC name is (1-phenyltetrazol-5-yl)methyl thieno[3,2-b][1]benzothiole-2-carboxylate.
Molecular Properties
| Compound Name | (1-phenyltetrazol-5-yl)methyl thieno[3,2-b][1]benzothiole-2-carboxylate |
| PubChem CID | 24501181 |
| Molecular Formula | C19H12N4O2S2 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | (1-phenyltetrazol-5-yl)methyl thieno[3,2-b][1]benzothiole-2-carboxylate |
| SMILES | O=C(OCc1nnnn1-c1ccccc1)c1cc2sc3ccccc3c2s1 |
| InChI | InChI=1S/C19H12N4O2S2/c24-19(16-10-15-18(27-16)13-8-4-5-9-14(13)26-15)25-11-17-20-21-22-23(17)12-6-2-1-3-7-12/h1-10H,11H2 |
| InChIKey | KCWQXQUNXYNDBR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (1-phenyltetrazol-5-yl)methyl thieno[3,2-b][1]benzothiole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-phenyltetrazol-5-yl)methyl thieno[3,2-b][1]benzothiole-2-carboxylate?
The IUPAC name of (1-phenyltetrazol-5-yl)methyl thieno[3,2-b][1]benzothiole-2-carboxylate (CID 24501181) is (1-phenyltetrazol-5-yl)methyl thieno[3,2-b][1]benzothiole-2-carboxylate.
What is the SMILES notation for (1-phenyltetrazol-5-yl)methyl thieno[3,2-b][1]benzothiole-2-carboxylate?
The canonical SMILES for (1-phenyltetrazol-5-yl)methyl thieno[3,2-b][1]benzothiole-2-carboxylate is O=C(OCc1nnnn1-c1ccccc1)c1cc2sc3ccccc3c2s1.
What is the InChIKey of (1-phenyltetrazol-5-yl)methyl thieno[3,2-b][1]benzothiole-2-carboxylate?
The InChIKey is KCWQXQUNXYNDBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12N4O2S2/c24-19(16-10-15-18(27-16)13-8-4-5-9-14(13)26-15)25-11-17-20-21-22-23(17)12-6-2-1-3-7-12/h1-10H,11H2.
What are the key properties of (1-phenyltetrazol-5-yl)methyl thieno[3,2-b][1]benzothiole-2-carboxylate?
(1-phenyltetrazol-5-yl)methyl thieno[3,2-b][1]benzothiole-2-carboxylate has a molecular weight of 392.47 g/mol, XLogP of 4.45, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (1-phenyltetrazol-5-yl)methyl thieno[3,2-b][1]benzothiole-2-carboxylate is sourced from PubChem (CID 24501181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).