About (1-phenyltetrazol-5-yl)methyl 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate
(1-phenyltetrazol-5-yl)methyl 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate (PubChem CID 24501424) has the molecular formula C25H19N5O3
and a molecular weight of 437.46 g/mol. Its IUPAC name is (1-phenyltetrazol-5-yl)methyl 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate.
Molecular Properties
| Compound Name | (1-phenyltetrazol-5-yl)methyl 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate |
| PubChem CID | 24501424 |
| Molecular Formula | C25H19N5O3 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | (1-phenyltetrazol-5-yl)methyl 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate |
| SMILES | Cc1ccc(-c2cnc(-c3ccccc3C(=O)OCc3nnnn3-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C25H19N5O3/c1-17-11-13-18(14-12-17)22-15-26-24(33-22)20-9-5-6-10-21(20)25(31)32-16-23-27-28-29-30(23)19-7-3-2-4-8-19/h2-15H,16H2,1H3 |
| InChIKey | GRFUJIBFTIUJAX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 95.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (1-phenyltetrazol-5-yl)methyl 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-phenyltetrazol-5-yl)methyl 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate?
The IUPAC name of (1-phenyltetrazol-5-yl)methyl 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate (CID 24501424) is (1-phenyltetrazol-5-yl)methyl 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate.
What is the SMILES notation for (1-phenyltetrazol-5-yl)methyl 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate?
The canonical SMILES for (1-phenyltetrazol-5-yl)methyl 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate is Cc1ccc(-c2cnc(-c3ccccc3C(=O)OCc3nnnn3-c3ccccc3)o2)cc1.
What is the InChIKey of (1-phenyltetrazol-5-yl)methyl 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate?
The InChIKey is GRFUJIBFTIUJAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19N5O3/c1-17-11-13-18(14-12-17)22-15-26-24(33-22)20-9-5-6-10-21(20)25(31)32-16-23-27-28-29-30(23)19-7-3-2-4-8-19/h2-15H,16H2,1H3.
What are the key properties of (1-phenyltetrazol-5-yl)methyl 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate?
(1-phenyltetrazol-5-yl)methyl 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate has a molecular weight of 437.46 g/mol, XLogP of 4.65, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (1-phenyltetrazol-5-yl)methyl 2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]benzoate is sourced from PubChem (CID 24501424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).