C19H21N3O2S2 — CID 24502026
3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]propanamide (PubChem CID 24502026) has the molecular formula C19H21N3O2S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]propanamide.
| Compound Name | 3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]propanamide |
|---|---|
| PubChem CID | 24502026 |
| Molecular Formula | C19H21N3O2S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]propanamide |
| SMILES | Cc1ccc(-c2noc(CCC(=O)NCCSCc3ccsc3)n2)cc1 |
| InChI | InChI=1S/C19H21N3O2S2/c1-14-2-4-16(5-3-14)19-21-18(24-22-19)7-6-17(23)20-9-11-26-13-15-8-10-25-12-15/h2-5,8,10,12H,6-7,9,11,13H2,1H3,(H,20,23) |
| InChIKey | UCASYZCVZSGOSN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|