C23H22ClN3O3 — CID 24503369
1-(4-chlorophenyl)-N,6-dimethyl-4-oxo-N-[(4-prop-2-enoxyphenyl)methyl]pyridazine-3-carboxamide (PubChem CID 24503369) has the molecular formula C23H22ClN3O3 and a molecular weight of 423.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N,6-dimethyl-4-oxo-N-[(4-prop-2-enoxyphenyl)methyl]pyridazine-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N,6-dimethyl-4-oxo-N-[(4-prop-2-enoxyphenyl)methyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 24503369 |
| Molecular Formula | C23H22ClN3O3 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 1-(4-chlorophenyl)-N,6-dimethyl-4-oxo-N-[(4-prop-2-enoxyphenyl)methyl]pyridazine-3-carboxamide |
| SMILES | C=CCOc1ccc(CN(C)C(=O)c2nn(-c3ccc(Cl)cc3)c(C)cc2=O)cc1 |
| InChI | InChI=1S/C23H22ClN3O3/c1-4-13-30-20-11-5-17(6-12-20)15-26(3)23(29)22-21(28)14-16(2)27(25-22)19-9-7-18(24)8-10-19/h4-12,14H,1,13,15H2,2-3H3 |
| InChIKey | OTYUOMQJVDFCOM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|