C28H41N3O3 — CID 24505107
N-[4-[[1-(4-methylphenyl)-2-morpholin-4-ylethyl]amino]-4-oxobutyl]adamantane-1-carboxamide (PubChem CID 24505107) has the molecular formula C28H41N3O3 and a molecular weight of 467.65 g/mol. Its IUPAC name is N-[4-[[1-(4-methylphenyl)-2-morpholin-4-ylethyl]amino]-4-oxobutyl]adamantane-1-carboxamide.
| Compound Name | N-[4-[[1-(4-methylphenyl)-2-morpholin-4-ylethyl]amino]-4-oxobutyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 24505107 |
| Molecular Formula | C28H41N3O3 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.31 |
| IUPAC Name | N-[4-[[1-(4-methylphenyl)-2-morpholin-4-ylethyl]amino]-4-oxobutyl]adamantane-1-carboxamide |
| SMILES | Cc1ccc(C(CN2CCOCC2)NC(=O)CCCNC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C28H41N3O3/c1-20-4-6-24(7-5-20)25(19-31-9-11-34-12-10-31)30-26(32)3-2-8-29-27(33)28-16-21-13-22(17-28)15-23(14-21)18-28/h4-7,21-23,25H,2-3,8-19H2,1H3,(H,29,33)(H,30,32) |
| InChIKey | XEIMALXIBDCVHK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|