C18H21FN2O5S — CID 2450711
2-fluoro-N-methyl-N-[(5-methylfuran-2-yl)methyl]-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 2450711) has the molecular formula C18H21FN2O5S and a molecular weight of 396.44 g/mol. Its IUPAC name is 2-fluoro-N-methyl-N-[(5-methylfuran-2-yl)methyl]-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 2-fluoro-N-methyl-N-[(5-methylfuran-2-yl)methyl]-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 2450711 |
| Molecular Formula | C18H21FN2O5S |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 2-fluoro-N-methyl-N-[(5-methylfuran-2-yl)methyl]-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | Cc1ccc(CN(C)C(=O)c2cc(S(=O)(=O)N3CCOCC3)ccc2F)o1 |
| InChI | InChI=1S/C18H21FN2O5S/c1-13-3-4-14(26-13)12-20(2)18(22)16-11-15(5-6-17(16)19)27(23,24)21-7-9-25-10-8-21/h3-6,11H,7-10,12H2,1-2H3 |
| InChIKey | VNKYPBBNQPXRTF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |