C18H29N3O3 — CID 24507139
N-[2-(4-methoxyphenyl)ethyl]-2-[methyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]propanamide (PubChem CID 24507139) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-2-[methyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]propanamide.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-2-[methyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]propanamide |
|---|---|
| PubChem CID | 24507139 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-2-[methyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]propanamide |
| SMILES | COc1ccc(CCNC(=O)C(C)N(C)CC(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C18H29N3O3/c1-13(2)20-17(22)12-21(4)14(3)18(23)19-11-10-15-6-8-16(24-5)9-7-15/h6-9,13-14H,10-12H2,1-5H3,(H,19,23)(H,20,22) |
| InChIKey | VENGXQZTVRBTBB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |