C17H17N3S — CID 24508226
4-ethyl-5-quinazolin-4-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 24508226) has the molecular formula C17H17N3S and a molecular weight of 295.41 g/mol. Its IUPAC name is 4-ethyl-5-quinazolin-4-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine.
| Compound Name | 4-ethyl-5-quinazolin-4-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 24508226 |
| Molecular Formula | C17H17N3S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 4-ethyl-5-quinazolin-4-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | CCC1c2ccsc2CCN1c1ncnc2ccccc12 |
| InChI | InChI=1S/C17H17N3S/c1-2-15-13-8-10-21-16(13)7-9-20(15)17-12-5-3-4-6-14(12)18-11-19-17/h3-6,8,10-11,15H,2,7,9H2,1H3 |
| InChIKey | OWZCUNHMHRFBBL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |