About 5-[[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]methyl]thiophene-2-sulfonamide
5-[[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]methyl]thiophene-2-sulfonamide (PubChem CID 24508637) has the molecular formula C10H9N5O4S3
and a molecular weight of 359.41 g/mol. Its IUPAC name is 5-[[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]methyl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-[[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]methyl]thiophene-2-sulfonamide |
| PubChem CID | 24508637 |
| Molecular Formula | C10H9N5O4S3 |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | 5-[[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]methyl]thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CNc2nc3sccn3c2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C10H9N5O4S3/c11-22(18,19)7-2-1-6(21-7)5-12-8-9(15(16)17)14-3-4-20-10(14)13-8/h1-4,12H,5H2,(H2,11,18,19) |
| InChIKey | UTYYPJINIURJJY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]methyl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]methyl]thiophene-2-sulfonamide?
The IUPAC name of 5-[[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]methyl]thiophene-2-sulfonamide (CID 24508637) is 5-[[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]methyl]thiophene-2-sulfonamide.
What is the SMILES notation for 5-[[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]methyl]thiophene-2-sulfonamide?
The canonical SMILES for 5-[[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]methyl]thiophene-2-sulfonamide is NS(=O)(=O)c1ccc(CNc2nc3sccn3c2[N+](=O)[O-])s1.
What is the InChIKey of 5-[[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]methyl]thiophene-2-sulfonamide?
The InChIKey is UTYYPJINIURJJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N5O4S3/c11-22(18,19)7-2-1-6(21-7)5-12-8-9(15(16)17)14-3-4-20-10(14)13-8/h1-4,12H,5H2,(H2,11,18,19).
What are the key properties of 5-[[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]methyl]thiophene-2-sulfonamide?
5-[[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]methyl]thiophene-2-sulfonamide has a molecular weight of 359.41 g/mol, XLogP of 1.62, 5 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]methyl]thiophene-2-sulfonamide is sourced from PubChem (CID 24508637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).