About 1-(4-fluorophenyl)-5-methyl-N-(2-phenylphenyl)-1,2,4-triazole-3-carboxamide
1-(4-fluorophenyl)-5-methyl-N-(2-phenylphenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 24508971) has the molecular formula C22H17FN4O
and a molecular weight of 372.40 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-methyl-N-(2-phenylphenyl)-1,2,4-triazole-3-carboxamide.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)-5-methyl-N-(2-phenylphenyl)-1,2,4-triazole-3-carboxamide |
| PubChem CID | 24508971 |
| Molecular Formula | C22H17FN4O |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 1-(4-fluorophenyl)-5-methyl-N-(2-phenylphenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2ccccc2-c2ccccc2)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H17FN4O/c1-15-24-21(26-27(15)18-13-11-17(23)12-14-18)22(28)25-20-10-6-5-9-19(20)16-7-3-2-4-8-16/h2-14H,1H3,(H,25,28) |
| InChIKey | WOAOXRPUWPISIR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-fluorophenyl)-5-methyl-N-(2-phenylphenyl)-1,2,4-triazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)-5-methyl-N-(2-phenylphenyl)-1,2,4-triazole-3-carboxamide?
The IUPAC name of 1-(4-fluorophenyl)-5-methyl-N-(2-phenylphenyl)-1,2,4-triazole-3-carboxamide (CID 24508971) is 1-(4-fluorophenyl)-5-methyl-N-(2-phenylphenyl)-1,2,4-triazole-3-carboxamide.
What is the SMILES notation for 1-(4-fluorophenyl)-5-methyl-N-(2-phenylphenyl)-1,2,4-triazole-3-carboxamide?
The canonical SMILES for 1-(4-fluorophenyl)-5-methyl-N-(2-phenylphenyl)-1,2,4-triazole-3-carboxamide is Cc1nc(C(=O)Nc2ccccc2-c2ccccc2)nn1-c1ccc(F)cc1.
What is the InChIKey of 1-(4-fluorophenyl)-5-methyl-N-(2-phenylphenyl)-1,2,4-triazole-3-carboxamide?
The InChIKey is WOAOXRPUWPISIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17FN4O/c1-15-24-21(26-27(15)18-13-11-17(23)12-14-18)22(28)25-20-10-6-5-9-19(20)16-7-3-2-4-8-16/h2-14H,1H3,(H,25,28).
What are the key properties of 1-(4-fluorophenyl)-5-methyl-N-(2-phenylphenyl)-1,2,4-triazole-3-carboxamide?
1-(4-fluorophenyl)-5-methyl-N-(2-phenylphenyl)-1,2,4-triazole-3-carboxamide has a molecular weight of 372.40 g/mol, XLogP of 4.63, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)-5-methyl-N-(2-phenylphenyl)-1,2,4-triazole-3-carboxamide is sourced from PubChem (CID 24508971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).