About 1,2-dimethoxypropane
1,2-dimethoxypropane (PubChem CID 24509) has the molecular formula C5H12O2
and a molecular weight of 104.15 g/mol. Its IUPAC name is 1,2-dimethoxypropane.
Molecular Properties
| Compound Name | 1,2-dimethoxypropane |
| PubChem CID | 24509 |
| Molecular Formula | C5H12O2 |
| Molecular Weight | 104.15 g/mol |
| Exact Mass | 104.08 |
| IUPAC Name | 1,2-dimethoxypropane |
| SMILES | COCC(C)OC |
| InChI | InChI=1S/C5H12O2/c1-5(7-3)4-6-2/h5H,4H2,1-3H3 |
| InChIKey | LEEANUDEDHYDTG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.15 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-dimethoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethoxypropane?
The IUPAC name of 1,2-dimethoxypropane (CID 24509) is 1,2-dimethoxypropane.
What is the SMILES notation for 1,2-dimethoxypropane?
The canonical SMILES for 1,2-dimethoxypropane is COCC(C)OC.
What is the InChIKey of 1,2-dimethoxypropane?
The InChIKey is LEEANUDEDHYDTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2/c1-5(7-3)4-6-2/h5H,4H2,1-3H3.
What are the key properties of 1,2-dimethoxypropane?
1,2-dimethoxypropane has a molecular weight of 104.15 g/mol, XLogP of 0.67, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethoxypropane is sourced from PubChem (CID 24509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).