C23H26ClN3O3S2 — CID 24509470
N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanylbutanamide (PubChem CID 24509470) has the molecular formula C23H26ClN3O3S2 and a molecular weight of 492.07 g/mol. Its IUPAC name is N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanylbutanamide.
| Compound Name | N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 24509470 |
| Molecular Formula | C23H26ClN3O3S2 |
| Molecular Weight | 492.07 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanylbutanamide |
| SMILES | CSCCC(C(=O)Nc1ncc(Cc2ccc(Cl)cc2)s1)N1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C23H26ClN3O3S2/c1-31-11-10-19(27-21(29)17-4-2-3-5-18(17)22(27)30)20(28)26-23-25-13-16(32-23)12-14-6-8-15(24)9-7-14/h6-9,13,17-19H,2-5,10-12H2,1H3,(H,25,26,28) |
| InChIKey | LXNAYCFOCYDOFA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.07 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|