C18H17Cl2N3O3 — CID 24509561
4-[2-(2,4-dichloro-6-methyl-3-pyridinyl)acetyl]-N-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 24509561) has the molecular formula C18H17Cl2N3O3 and a molecular weight of 394.26 g/mol. Its IUPAC name is 4-[2-(2,4-dichloro-6-methyl-3-pyridinyl)acetyl]-N-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | 4-[2-(2,4-dichloro-6-methyl-3-pyridinyl)acetyl]-N-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 24509561 |
| Molecular Formula | C18H17Cl2N3O3 |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 4-[2-(2,4-dichloro-6-methyl-3-pyridinyl)acetyl]-N-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CNC(=O)C1CN(C(=O)Cc2c(Cl)cc(C)nc2Cl)c2ccccc2O1 |
| InChI | InChI=1S/C18H17Cl2N3O3/c1-10-7-12(19)11(17(20)22-10)8-16(24)23-9-15(18(25)21-2)26-14-6-4-3-5-13(14)23/h3-7,15H,8-9H2,1-2H3,(H,21,25) |
| InChIKey | AVXWXGKEETYZDR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|