C13H8F3N5O2S — CID 2451006
2,3,4-trifluoro-N-[4-(tetrazol-1-yl)phenyl]benzenesulfonamide (PubChem CID 2451006) has the molecular formula C13H8F3N5O2S and a molecular weight of 355.30 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[4-(tetrazol-1-yl)phenyl]benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-[4-(tetrazol-1-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2451006 |
| Molecular Formula | C13H8F3N5O2S |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 2,3,4-trifluoro-N-[4-(tetrazol-1-yl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-n2cnnn2)cc1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H8F3N5O2S/c14-10-5-6-11(13(16)12(10)15)24(22,23)18-8-1-3-9(4-2-8)21-7-17-19-20-21/h1-7,18H |
| InChIKey | NULRYQHDAKPZJA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|