C18H15ClN2O2S — CID 24510479
(5E)-5-[(5-chloro-2-hydroxyphenyl)methylidene]-3-(2-ethylphenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 24510479) has the molecular formula C18H15ClN2O2S and a molecular weight of 358.85 g/mol. Its IUPAC name is (5E)-5-[(5-chloro-2-hydroxyphenyl)methylidene]-3-(2-ethylphenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[(5-chloro-2-hydroxyphenyl)methylidene]-3-(2-ethylphenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 24510479 |
| Molecular Formula | C18H15ClN2O2S |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | (5E)-5-[(5-chloro-2-hydroxyphenyl)methylidene]-3-(2-ethylphenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCc1ccccc1N1C(=O)/C(=C\c2cc(Cl)ccc2O)NC1=S |
| InChI | InChI=1S/C18H15ClN2O2S/c1-2-11-5-3-4-6-15(11)21-17(23)14(20-18(21)24)10-12-9-13(19)7-8-16(12)22/h3-10,22H,2H2,1H3,(H,20,24)/b14-10+ |
| InChIKey | MTWOHIHFOCXSLZ-GXDHUFHOSA-N |
| XLogP | 3.87 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|