About 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonyl-ethylamino]-N-ethylacetamide
2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonyl-ethylamino]-N-ethylacetamide (PubChem CID 24510969) has the molecular formula C12H20N4O5S
and a molecular weight of 332.38 g/mol. Its IUPAC name is 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonyl-ethylamino]-N-ethylacetamide.
Molecular Properties
| Compound Name | 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonyl-ethylamino]-N-ethylacetamide |
| PubChem CID | 24510969 |
| Molecular Formula | C12H20N4O5S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonyl-ethylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CN(CC)S(=O)(=O)c1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C12H20N4O5S/c1-5-13-10(17)8-16(6-2)22(20,21)9-7-14(3)12(19)15(4)11(9)18/h7H,5-6,8H2,1-4H3,(H,13,17) |
| InChIKey | JDYYVXGKWRDXHM-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 110.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonyl-ethylamino]-N-ethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonyl-ethylamino]-N-ethylacetamide?
The IUPAC name of 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonyl-ethylamino]-N-ethylacetamide (CID 24510969) is 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonyl-ethylamino]-N-ethylacetamide.
What is the SMILES notation for 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonyl-ethylamino]-N-ethylacetamide?
The canonical SMILES for 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonyl-ethylamino]-N-ethylacetamide is CCNC(=O)CN(CC)S(=O)(=O)c1cn(C)c(=O)n(C)c1=O.
What is the InChIKey of 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonyl-ethylamino]-N-ethylacetamide?
The InChIKey is JDYYVXGKWRDXHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O5S/c1-5-13-10(17)8-16(6-2)22(20,21)9-7-14(3)12(19)15(4)11(9)18/h7H,5-6,8H2,1-4H3,(H,13,17).
What are the key properties of 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonyl-ethylamino]-N-ethylacetamide?
2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonyl-ethylamino]-N-ethylacetamide has a molecular weight of 332.38 g/mol, XLogP of -1.77, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonyl-ethylamino]-N-ethylacetamide is sourced from PubChem (CID 24510969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).