C19H18F2N2O5 — CID 24511676
methyl 4-[(E)-[1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]oxyiminomethyl]benzoate (PubChem CID 24511676) has the molecular formula C19H18F2N2O5 and a molecular weight of 392.36 g/mol. Its IUPAC name is methyl 4-[(E)-[1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]oxyiminomethyl]benzoate.
| Compound Name | methyl 4-[(E)-[1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]oxyiminomethyl]benzoate |
|---|---|
| PubChem CID | 24511676 |
| Molecular Formula | C19H18F2N2O5 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | methyl 4-[(E)-[1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]oxyiminomethyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N/OC(C)C(=O)Nc2ccccc2OC(F)F)cc1 |
| InChI | InChI=1S/C19H18F2N2O5/c1-12(17(24)23-15-5-3-4-6-16(15)27-19(20)21)28-22-11-13-7-9-14(10-8-13)18(25)26-2/h3-12,19H,1-2H3,(H,23,24)/b22-11+ |
| InChIKey | BNQFJRSXPWAIJB-SSDVNMTOSA-N |
| XLogP | 3.45 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|