C21H26N4O2S2 — CID 24512160
N-benzyl-5-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-3-methyl-6H-1,3,4-thiadiazin-2-imine (PubChem CID 24512160) has the molecular formula C21H26N4O2S2 and a molecular weight of 430.60 g/mol. Its IUPAC name is N-benzyl-5-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-3-methyl-6H-1,3,4-thiadiazin-2-imine.
| Compound Name | N-benzyl-5-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-3-methyl-6H-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 24512160 |
| Molecular Formula | C21H26N4O2S2 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | N-benzyl-5-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-3-methyl-6H-1,3,4-thiadiazin-2-imine |
| SMILES | Cc1cc(C2=NN(C)/C(=N/Cc3ccccc3)SC2)c(C)n1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H26N4O2S2/c1-15-11-19(16(2)25(15)18-9-10-29(26,27)14-18)20-13-28-21(24(3)23-20)22-12-17-7-5-4-6-8-17/h4-8,11,18H,9-10,12-14H2,1-3H3/b22-21- |
| InChIKey | IDBSDPMBMRNFTC-DQRAZIAOSA-N |
| XLogP | 3.40 |
| TPSA | 67.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|