C22H20FN5O2 — CID 24514017
N'-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-7-methylimidazo[1,2-a]pyridine-2-carbohydrazide (PubChem CID 24514017) has the molecular formula C22H20FN5O2 and a molecular weight of 405.43 g/mol. Its IUPAC name is N'-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-7-methylimidazo[1,2-a]pyridine-2-carbohydrazide.
| Compound Name | N'-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-7-methylimidazo[1,2-a]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 24514017 |
| Molecular Formula | C22H20FN5O2 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | N'-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-7-methylimidazo[1,2-a]pyridine-2-carbohydrazide |
| SMILES | Cc1ccn2cc(C(=O)NNC(=O)c3cc(C)n(-c4ccc(F)cc4)c3C)nc2c1 |
| InChI | InChI=1S/C22H20FN5O2/c1-13-8-9-27-12-19(24-20(27)10-13)22(30)26-25-21(29)18-11-14(2)28(15(18)3)17-6-4-16(23)5-7-17/h4-12H,1-3H3,(H,25,29)(H,26,30) |
| InChIKey | LSTSWFGVXWYNSF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 80.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|