C21H23N3OS — CID 24515240
N-methyl-N-[(4-methylsulfanylphenyl)methyl]-3-(1-phenylpyrazol-4-yl)propanamide (PubChem CID 24515240) has the molecular formula C21H23N3OS and a molecular weight of 365.50 g/mol. Its IUPAC name is N-methyl-N-[(4-methylsulfanylphenyl)methyl]-3-(1-phenylpyrazol-4-yl)propanamide.
| Compound Name | N-methyl-N-[(4-methylsulfanylphenyl)methyl]-3-(1-phenylpyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 24515240 |
| Molecular Formula | C21H23N3OS |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-methyl-N-[(4-methylsulfanylphenyl)methyl]-3-(1-phenylpyrazol-4-yl)propanamide |
| SMILES | CSc1ccc(CN(C)C(=O)CCc2cnn(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C21H23N3OS/c1-23(15-17-8-11-20(26-2)12-9-17)21(25)13-10-18-14-22-24(16-18)19-6-4-3-5-7-19/h3-9,11-12,14,16H,10,13,15H2,1-2H3 |
| InChIKey | GBDBVSGTVTYDCR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |