C27H25ClN4O2 — CID 24516184
N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-4-(4-oxoquinazolin-3-yl)benzamide (PubChem CID 24516184) has the molecular formula C27H25ClN4O2 and a molecular weight of 472.98 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-4-(4-oxoquinazolin-3-yl)benzamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-4-(4-oxoquinazolin-3-yl)benzamide |
|---|---|
| PubChem CID | 24516184 |
| Molecular Formula | C27H25ClN4O2 |
| Molecular Weight | 472.98 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-4-(4-oxoquinazolin-3-yl)benzamide |
| SMILES | O=C(NC1CCN(Cc2ccc(Cl)cc2)CC1)c1ccc(-n2cnc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C27H25ClN4O2/c28-21-9-5-19(6-10-21)17-31-15-13-22(14-16-31)30-26(33)20-7-11-23(12-8-20)32-18-29-25-4-2-1-3-24(25)27(32)34/h1-12,18,22H,13-17H2,(H,30,33) |
| InChIKey | NBJHYJJQLTWPND-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.98 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |