C19H24N2O2S — CID 24516413
N-(3-cyclohexyloxypropyl)-2-phenyl-1,3-thiazole-4-carboxamide (PubChem CID 24516413) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is N-(3-cyclohexyloxypropyl)-2-phenyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3-cyclohexyloxypropyl)-2-phenyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 24516413 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | N-(3-cyclohexyloxypropyl)-2-phenyl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCCOC1CCCCC1)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H24N2O2S/c22-18(20-12-7-13-23-16-10-5-2-6-11-16)17-14-24-19(21-17)15-8-3-1-4-9-15/h1,3-4,8-9,14,16H,2,5-7,10-13H2,(H,20,22) |
| InChIKey | NFJJPWFUULTFOR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|